catena-Poly[[aqua(11-chloropyrido[2',3':2,3]pyrimidino[5,6-f][1,10]phenanthroline-kappa2N4,N5)cadmium(II)]-mu-benzene-1,4-dicarboxylato-kappa3O1,O1':O4]: an inclined interpenetrating (6,3) network.

The asymmetric unit of the title compound, Cd(C(8)H(4)O(4))(C(17)H(8)ClN(5))(H(2)O), contains one Cd(II) atom, two half benzene-1,4-dicarboxylate (1,4-bdc) anions, one 11-chloropyrido[2',3':2,3]pyrimidino[5,6-f][1,10]phenanthroline (L) ligand and one coordination water molecule. The 1,4-bdc ligands are on inversion centers at the centroids of the arene rings. The Cd(II) atom is six-coordinated by two N atoms from one L ligand, three carboxylate O atoms from two different 1,4-bdc ligands and one water O atom in a distorted octahedral coordination sphere. Each Cd(II) center is bridged by the 1,4-bdc dianions to give a one-dimensional chain. Pi-pi stacking interactions between L ligands of neighboring chains extend adjacent chains into a two-dimensional supramolecular (6,3) network. Neighboring (6,3) networks are interpenetrated in an unusual inclined mode, resulting in a three-dimensional framework. Additionally, the water-carboxylate O-H...O hydrogen bonds observed in the network consolidate the interpenetrating nets.