catena-Poly[[bis(pentane-2,4-dionato-kappa2O,O')cobalt(II)]-mu-4,4'-methylenedianiline-kappa2N:N'].

In the title compound, Co(C(5)H(7)O(2))(2)(C(13)H(14)N(2)) or Co(acac)(2)(dadpm), where acac is acetylacetonate and dadpm is 4,4'-methylenedianiline, the Co atom is on a centre of symmetry and is octahedrally coordinated by four O atoms from two acac anions and by two N atoms from two dadpm ligands. Each dadpm ligand, which has a twofold axis passing through its methylene C atom, bridges two Co atoms to form a spiral polymeric chain. Neighbouring chains connect via hydrogen bonds to form a two-dimensional network.