{mu-N,N'-Bis[3-(dimethylamino)propyl]oxamidato(2-)-kappa(6)N,N',O':N'',N''',O}bis[(1H-imidazole-kappaN3)(methanol-kappaO)copper(II)] bis(perchlorate).

The structure of the title compound, Cu2(C12H24N4O2)(C3H4N2)2(CH4O)22 or Cu2(dmoxpn)(HIm)2(CH3OH)22, where dmoxpn is the dianion of N,N'-bis[3-(dimethylamino)propyl]oxamide and HIm is imidazole, consists of a centrosymmetric trans-oxamidate-bridged copper(II) binuclear cation, having an inversion centre at the mid-point of the central C-C bond, and two perchlorate anions. The Cu(II) atom has square-pyramidal coordination geometry involving two N atoms and an O atom from the dmoxpn ligand, an N atom from an imidazole ring, and an O atom from a methanol molecule. The crystal structure is stabilized by O-H...O, N-H...O and C-H...O hydrogen bonds and imidazole pi-pi stacking interactions to form a three-dimensional supramolecular array.