Di-μ-methacrylato-κO:O'-bis-[aqua-bis(1,10-phenanthroline-κN,N')copper(II)] dinitrate dihydrate.

The title complex, Cu(2)(C(4)H(5)O(2))(2)(C(12)H(8)N(2))(2)(H(2)O)(2)(2)·2H(2)O, contains a dimeric Cu(2)(C(4)H(5)O(2))(2)(C(12)H(8)N(2))(2)(H(2)O)(2) dication with two five-coordinated Cu(II) ions linked by two methacrylate ions in a syn-syn bridging arrangement. The dication possesses pseudo-twofold rotational symmetry. The penta-coordination of each Cu(II) ion has a distorted square-pyramidal geometry, with two N donors from a phenanthroline ligand and two carboxyl-ate O atoms occupying basal sites and the apical position being occupied by a water mol-ecule. In the crystal packing, mol-ecules are linked to form a three-dimensional framework by O-H⋯O and C-H⋯O hydrogen bonds and π-π inter-actions [centroid-centroid distances of 3.6039 (15), 3.5301 (15), 3.6015 (15), 3.6496 (15) and 3.6858 (15) Å].