catena-Poly[[(2,2'-bipyrimidine-κN,N)diperchloratocopper(II)]-μ-4,4'-bipyridine-κN:N'].

The central CuN(4)O(2) motif of the title compound, Cu(ClO(4))(2)(C(8)H(6)N(4))(C(10)H(8)N(2)), exhibits a Jahn-Teller-distorted octa-hedral geometry around the metal centre, showing a considerably long Cu-O bond distance of 2.634 (4) Å towards the second perchlorate group occupying the sixth coordination site, giving a (4+1+1)-type coordination mode. The 4,4'-bipyridine (bipy) ligands are highly twisted with respect to each other, the dihedral angle between the two pyridyl ring planes being 38.9 (2)°. The bipy ligands act as bridging ligands between [Cu(ClO(4))(2)(2,2'-bpym)] (2,2'-bpym is 2,2'-bipyrimidine) units, generating an infinite one-dimensional zigzag chain along [010]. Intra- and intermolecular C-H⋯O hydrogen bonds are present in the crystal structure.