(μ-3,4-Diacetyl-hexa-2,4-diene-2,5-diol-ato-κO,O:O,O)bis-[aqua(1,10-phen-an-thro-line-κN,N')copper(II)] bis-(tetra-fluorid-oborate) monohydrate.

In the title compound, Cu(2)(C(10)H(12)O(4))(C(12)H(8)N(2))(2)(H(2)O)(2)(2)·H(2)O, the two Cu atoms are each chelated by the acetyl-acetonate unit of the 3,4-diacetyl-hexa-2,4-diene-2,5-diolate (tae) ligand. The Cu atoms are square-pyramidally penta-coordinated, with one bidentate 1,10-phenanthroline (phen) and the tae ligand basal and one water mol-ecule apical. The pyridyl rings of the phen ligands participate in π-π [centroid-centroid distance = 3.894 (3) Å] and C-H ⋯ π inter-actions, generating layers which are inter-connected through O-H⋯O and O-H⋯F hydrogen bonds between the water mol-ecules and the tetra-fluorido-borate anions. The F atoms of both tetra-fluorido-borate anions are each disordered over two positions of equal occupancy.