catena-Poly[[aqua-bis-(N-benzyl-adenine-κN)copper(II)]-μ-benzene-1,4-dicarboxyl-ato-κO:O].

In the title compound, Cu(C(8)H(4)O(4))(C(12)H(11)N(5))(2)(H(2)O), the Cu(II) ion is five-coordinated by two carboxyl-ate O atoms from two symmetry-related benzene-1,4-dicarboxyl-ate ligands, two N atoms from two symmetry-related N(6)-benzyl-adenine ligands and one water O atom in a square-pyramidal environment. The Cu(II) and water O atoms lie on a twofold rotation axis, and the benzene-1,4-dicarboxyl-ate ligand lies on an inversion center. The water O atom occupies the apical position and the basal plane is occupied by two O atoms and two N atoms. Each benzene-1,4-dicarboxyl-ate anion acts as a bis-monodentate ligand that binds two Cu(II) cations, forming an infinite chain extending parallel to [001]. The N(6)-benzyl-adenine ligands are attached on both sides of the chain. Neighboring chains are further inter-connected into the resulting three-dimensional supra-molecular architecture via O-H⋯O, N-H⋯O and N-H⋯N hydrogen bonds.