catena-Poly[[aqua-bis-(pyridine-κN)copper(II)]-μ-2,2'-(p-phenyl-enedi-oxy)diacetato-κO:O'].

In the title compound, Cu(C(10)H(8)O(6))(C(5)H(5)N)(2)(H(2)O), the Cu atom is five-coordinated by two O atoms from two carboxyl-ate groups of two different 2,2'-(p-phenyl-enedi-oxy)diacetate ligands, two N atoms from two pyridine mol-ecules and one water O atom. The geometry is square-pyramidal with the water O atom occupying the apical position. The carboxyl-ate group bridges adjacent Cu atoms, forming an infinite zigzag chain extending parallel to [001]. The chains are linked into layers by O-H⋯O hydrogen bonds. The Cu and water O atoms lie on special positions of site symmetry 2.