The structures and magnetic properties of self-assembled copper(II) clusters and grids with the "tritopic" ligands 2poap (a), Cl2poap (b), m2poap (c), Cl2pomp (d), and 2pomp (e) are described [ligands derived by reaction of 4-R-2,6-pyridinedicarboxylic hydrazide (R = H, Cl, MeO) with 2-pyridinemethylimidate (a-c, respectively) or 2-acetylpyridine (d, R = Cl; e, R = H)]. Cl2poap and Cl2pomp self-assemble with Cu(NO(3))(2) to form octanuclear "pinwheel" cluster complexes [Cu(8)(Cl2poap-2H)(4)(NO(3))(8)].20H(2)O (1) and [Cu(8)(Cl2pomp-2H)(4)(NO(3))(8)].15H(2)O (2), built on a square [2 x 2] grid with four pendant copper arms, using "mild" reaction conditions. Similar reactions of Cl2pomp and 2pomp with Cu(ClO(4))(2) produce pinwheel clusters Cu(8)(Cl2pomp-2H)(4)(H(2)O)(8)(8).7H(2)O (3) and Cu(8)(2pomp-2H)(4)(H(2)O)(8)(8) (4), respectively. Heating a solution of 1 in MeOH/H(2)O produces a [3 x 3] nonanuclear square grid complex, Cu(9)(Cl2poap-H)(3)(Cl2poap-2H)(3)(9).18H(2)O (5), which is also produced by direct reaction of the ligand and metal salt under similar conditions. Reaction of m2poap with Cu(NO(3))(2) produces only the [3 x 3] grid Cu(9)(m2poap-H)(2)(m2poap-2H)(4)(8).17H(2)O (6) under similar conditions. Mixing the tritopic ligand 2poap with pyridine-2,6-dicarboxylic acid (picd) in the presence of Cu(NO(3))(2) produces a remarkable mixed ligand, nonanuclear grid complex Cu(9)(2poap-H)(4)(picd-H)(3)(picd-2H)(9).9H(2)O (7), in which aromatic pi-stacking interactions are important in stabilizing the structure. Complexes 1-3 and 5-7 involve single oxygen atom (alkoxide) bridging connections between adjacent copper centers, while complex 4 has an unprecedented mixed micro-(N-N) and micro-O metal ion connectivity. Compound 1 (C(76)H(92)N(44)Cu(8)O(50)Cl(4)) crystallizes in the tetragonal system, space group I, with a = 21.645(1) A, c = 12.950(1) A, and Z = 2. Compound 2 (C(84)H(88)N(36)O(44)Cl(4)Cu(8)) crystallizes in the tetragonal system, space group I, with a = 21.2562(8) A, c = 12.7583(9) A, and Z = 2. Compound 4 (C(84)H(120)N(28)O(66)Cl(8)Cu(8)) crystallizes in the tetragonal system, space group I4(1)/a, with a = 20.7790(4) A, c = 32.561(1) A, and Z = 4. Compound 7(C(104)H(104)N(46)O(56)Cu(9)) crystallizes in the triclinic system, space group P, with a = 15.473(1) A, b = 19.869(2) A, c = 23.083(2) A, alpha = 88.890(2) degrees, beta = 81.511(2) degrees, gamma = 68.607(1) degrees, and Z = 2. All complexes exhibit dominant intramolecular ferromagnetic exchange coupling, resulting from an orthogonal bridging arrangement within each polynuclear structure.