catena-Poly[[aqua-(benzoato-κO,O')(benzoic acid-κO)calcium]-μ(3)-benzoato-κO:O,O':O'].

In title compound, Ca(C(7)H(5)O(2))(2)(C(7)H(6)O(2))(H(2)O), the eightfold-coordinated Ca(II) ion is bonded to four carboxyl-ate O atoms from two benzoate ions, an O atom from benzoic acid and a water O atom. One of the carboxyl-ate groups bridges adjacent Ca(2+) ions, forming a polymeric ribbon structure parallel to [010]. In the crystal, the benzoate anions and water mol-ecule inter-act by way of inter- and intra-molecular O-H⋯O hydrogen bonds.