Poly[[μ(2)-(1Z,N'E)-2-(1,3-benzothia-zol-2-ylsulfan-yl)-N'-(2-oxidobenzyl-idene-κO:O)acetohydrazidato-κO,N'](pyridine-κN)copper(II)].

In the title compound, Cu(C(16)H(11)N(3)O(2)S(2))(C(5)H(5)N), the Cu(II) atom displays a square-pyramidal CuN(2)O(3) coordination geometry with strong elongation in the vertex direction. The hydrazone mol-ecule is coordinated to the Cu(II) atom in a tridentate manner in the enolic form, creating five- and six-membered chelate metallarings. The pyridine mol-ecule completes the square-planar base of the copper coordination environment. The crystal structure displays zigzag polymeric Cu-O-Cu chains along [001]. Several weak π-π inter-actions between benzothia-zole rings were found in the same direction [centroid-centroid distances = 3.7484 (16), 3.7483 (16), 3.6731 (17) and 3.7649 (17) Å].