catena-Poly[[(pyridine-κN)copper(II)]-μ(3)-pyridine-2,6-dicarboxylato-κO:O,N,O:O].

In the title compound, Cu(C(7)H(3)NO(4))(C(5)H(5)N), the Cu(II) atom is in a slightly distorted octa-hedral coordination environment. Each Cu(II) atom is bound to two N atoms and one O atom of the pyridine-dicarboxyl-ate (PDA) ligand in a tridentate manner, one N atom of the pyridine mol-ecule and two bridging carboxyl-ate O atoms of adjacent PDA ligands, leading to a linear one-dimensional chain running along the c axis. These chains are further assembled via weak C-H⋯O and π-π inter-actions into a three-dimensional supra-molecular network structure. The centroid-centroid distance between the π-π inter-acting pyridine rings is 3.9104 (13) Å. The two N atoms are trans to each other with respect to Cu.