Poly[(μ(4)-3-carb-oxy-benzoato-κO:O,O:O:O)(quinolin-8-olato-κN,O)lead(II)].

The asymmetric unit of the title complex, Pb(C(8)H(5)O(4))(C(9)H(6)NO), comprises a Pb(II) cation, a quinolin-8-olate anion and a 3-carb-oxy-benzoate anion. The coordination geometry of the Pb(II) atom is defined by one N and six O atoms, as well as a stereochemically active lone pair of electrons, and is based on a Ψ-dodeca-hedron. The quinolin-8-olate is chelating and the 3-carb-oxy-benzoate anion forms bonds to four different Pb(II) atoms. The benzoate end of the 3-carb-oxy-benzoate ligand chelates one Pb(II) atom and simultaneously bridges two Pb(II) atoms on either side, forming a chain along the b axis. The carboxyl end of the 3-carb-oxy-benzoate connects to a neighbouring chain by employing its carbonyl atom to form a bond to a Pb(II) atom and the hydroxyl group to form a hydrogen bond to a quinolin-8-olate O atom. Thereby, a layer is formed in the bc plane.