(Acetato-κO)bis-(1,10-phenanthroline-κN,N')copper(II) acetate hepta-hydrate.

In the title complex, Cu(CH(3)CO(2))(C(12)H(8)N(2))(2)·7H(2)O, the central Cu(II) ion is five coordinate, being bound to four N atoms from two 1,10-phenanthroline ligands and one O atom from an acetate anion in a strongly distorted square-pyramidal configuration. Hydrogen-bonded water mol-ecules and an uncoordinated acetate anion form a two-dimensional polymeric structure parallel to (010). The cations are linked to this layer via O-H⋯O hydrogen bonds between one of the water mol-ecules and the coordinated acetate anion.